BIOCHEM C785 BIOCHEMISTRY
PREASSESSMENT PRACTICE EXAMINATION
2026 QUESTIONS WITH ANSWERS
GRADED A+
◍ as protons flow through ATP synthase and back into the mitochondrial
matrix.
Answer: Energy released ___ is utilized for the synthesis of ATP.
◍ Why are blood glucose levels high in patients with unmanaged Diabetes
Mellitus?Cells move too many GLUT4 transporters to their cell
membranes.Cells do not move enough GLUT4 transporters to their cell
membranes.Ketogenesis is suppressed in the liver.Ketogenesis is stimulated
in the liver..
Answer: Cells do not move enough GLUT4 transporters to their cell
membranes.GLUT4 transporters allow blood glucose to enter cells which
then lowers blood glucose levels.
◍ 3.
Answer: How many total ATP are invested in the urea cycle?
◍ synthesis of ATP from ADP + Pi.
Answer: Oxidative phosphorylation is the synthesis of ___ from ___.
◍ Why would a marathon runner consume a large meal full of complex
carbohydrates the night before her run?To replenish cellular stores of
proteinTo replenish cellular stores of ketone bodiesTo replenish cellular
stores of glycogenTo replenish cellular stores of DNA.
Answer: To replenish cellular stores of glycogenA large amount of
carbohydrates can be stored as glycogen and used during exercise.
,◍ arginine.
Answer: What amino acid is the following structure?
◍ NH4+ (amine group).
Answer: Oxidative deamination results in the removal of ___ from amino
acids.
◍ Which pair of amino acids will most likely interact through hydrophobic
forces between their side chains?.
Answer: Both of these amino acids are non-polar and therefore can interact
together with a hydrophobic interaction. Please note that the "S" in the
amino acid on the right is non-polar, while the "SH" group in answer choice
D is polar. The S must have an H to be polar and is otherwise non-polar.
◍ fumarate.
Answer: Which component of the urea cycle is also a member of the CAC?
◍ Which molecule signals the liver to release glucose by breaking down
glycogen?InsulinEicosanoidsATPGlucagon.
Answer: GlucagonInsulin release increases glycogenesis which forms new
glucose.
◍ complex II.
Answer: FADH2 donates electrons and H+ to complex
◍ muscle twitches, muscles weakness, and degradation of nerve cells.
Answer: An individual with the MERRF disease tends to have symptoms of
◍ ornithine.
Answer: What amino acid is the following structure?
◍ false.
Answer: T/F: There are 5 complexes associated with the ETC.
◍ What is the correct chemical formula of the following fatty
acid?CH3(CH2)4CH=CH(CH2)4COOHCH3CH2CH=CHCH2CH=CHCH2CH=CH(
Answer: CH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOHThe
given structure and formula match with 18 total carbons and three double
, bonds at the omega-3, omega-6, and omega-9 position.
◍ The enzyme glucokinase only binds its substrate glucose and converts
glucose into the product glucose-6-phosphate. Which property of enzymes is
described by this scenario?SpecificityActivation energyInduced fitReaction
rate.
Answer: SpecificityEnzymes have a high degree of specificity. They will
bind to one specific class of molecules and usually catalyze only one type of
reaction.
◍ What is the mRNA sequence that would result from this coding DNA
sequence: 5' - CAG TTA GAT TCA - 3'?5' - ACU UAG AUU GAC - 3'5' -
CUG TTU GUT TCU - 3'5' - CAG UUA GAU UCA - 3'5' - UGA AUC
UAA CUG - 3'.
Answer: 5' - CAG UUA GAU UCA - 3'The coding DNA and mRNA
sequences in transcription will be identical, except for any T in the coding
DNA sequence having a corresponding to U in the mRNA sequence. The
correct answer is 5'-CAG UUA GAU UCA-3'.
◍ Hemoglobin acts as a buffer to prevent blood from becoming too acidic by
binding ___.excess bicarbonateexcess oxygenexcess H+excess CO2.
Answer: excess H+H+ causes blood pH to drop and become acidic.
Hemoglobin binds to H+ which not only causes O2 to be released to the
tissues but also buffers the blood to allow the pH to increase.
◍ What property of hemoglobin, not observed in myoglobin, enables
hemoglobin to be an effective oxygen delivery molecule?Parabolic
curveBent shapeCooperativityHigh iron content.
Answer: CooperativityCooperative requires the subunits of hemoglobin to
work together so they all release O2 at the same time or are all binding O2
at the same time. Since myoglobin contains only one subunit, there is no
other group to "cooperate" with. Therefore, cooperativity is a feature
demonstrated by hemoglobin and not myoglobin.
◍ 2.5 ATP per NADH.
Answer: How many ATP molecules does NADH yield after donating
PREASSESSMENT PRACTICE EXAMINATION
2026 QUESTIONS WITH ANSWERS
GRADED A+
◍ as protons flow through ATP synthase and back into the mitochondrial
matrix.
Answer: Energy released ___ is utilized for the synthesis of ATP.
◍ Why are blood glucose levels high in patients with unmanaged Diabetes
Mellitus?Cells move too many GLUT4 transporters to their cell
membranes.Cells do not move enough GLUT4 transporters to their cell
membranes.Ketogenesis is suppressed in the liver.Ketogenesis is stimulated
in the liver..
Answer: Cells do not move enough GLUT4 transporters to their cell
membranes.GLUT4 transporters allow blood glucose to enter cells which
then lowers blood glucose levels.
◍ 3.
Answer: How many total ATP are invested in the urea cycle?
◍ synthesis of ATP from ADP + Pi.
Answer: Oxidative phosphorylation is the synthesis of ___ from ___.
◍ Why would a marathon runner consume a large meal full of complex
carbohydrates the night before her run?To replenish cellular stores of
proteinTo replenish cellular stores of ketone bodiesTo replenish cellular
stores of glycogenTo replenish cellular stores of DNA.
Answer: To replenish cellular stores of glycogenA large amount of
carbohydrates can be stored as glycogen and used during exercise.
,◍ arginine.
Answer: What amino acid is the following structure?
◍ NH4+ (amine group).
Answer: Oxidative deamination results in the removal of ___ from amino
acids.
◍ Which pair of amino acids will most likely interact through hydrophobic
forces between their side chains?.
Answer: Both of these amino acids are non-polar and therefore can interact
together with a hydrophobic interaction. Please note that the "S" in the
amino acid on the right is non-polar, while the "SH" group in answer choice
D is polar. The S must have an H to be polar and is otherwise non-polar.
◍ fumarate.
Answer: Which component of the urea cycle is also a member of the CAC?
◍ Which molecule signals the liver to release glucose by breaking down
glycogen?InsulinEicosanoidsATPGlucagon.
Answer: GlucagonInsulin release increases glycogenesis which forms new
glucose.
◍ complex II.
Answer: FADH2 donates electrons and H+ to complex
◍ muscle twitches, muscles weakness, and degradation of nerve cells.
Answer: An individual with the MERRF disease tends to have symptoms of
◍ ornithine.
Answer: What amino acid is the following structure?
◍ false.
Answer: T/F: There are 5 complexes associated with the ETC.
◍ What is the correct chemical formula of the following fatty
acid?CH3(CH2)4CH=CH(CH2)4COOHCH3CH2CH=CHCH2CH=CHCH2CH=CH(
Answer: CH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOHThe
given structure and formula match with 18 total carbons and three double
, bonds at the omega-3, omega-6, and omega-9 position.
◍ The enzyme glucokinase only binds its substrate glucose and converts
glucose into the product glucose-6-phosphate. Which property of enzymes is
described by this scenario?SpecificityActivation energyInduced fitReaction
rate.
Answer: SpecificityEnzymes have a high degree of specificity. They will
bind to one specific class of molecules and usually catalyze only one type of
reaction.
◍ What is the mRNA sequence that would result from this coding DNA
sequence: 5' - CAG TTA GAT TCA - 3'?5' - ACU UAG AUU GAC - 3'5' -
CUG TTU GUT TCU - 3'5' - CAG UUA GAU UCA - 3'5' - UGA AUC
UAA CUG - 3'.
Answer: 5' - CAG UUA GAU UCA - 3'The coding DNA and mRNA
sequences in transcription will be identical, except for any T in the coding
DNA sequence having a corresponding to U in the mRNA sequence. The
correct answer is 5'-CAG UUA GAU UCA-3'.
◍ Hemoglobin acts as a buffer to prevent blood from becoming too acidic by
binding ___.excess bicarbonateexcess oxygenexcess H+excess CO2.
Answer: excess H+H+ causes blood pH to drop and become acidic.
Hemoglobin binds to H+ which not only causes O2 to be released to the
tissues but also buffers the blood to allow the pH to increase.
◍ What property of hemoglobin, not observed in myoglobin, enables
hemoglobin to be an effective oxygen delivery molecule?Parabolic
curveBent shapeCooperativityHigh iron content.
Answer: CooperativityCooperative requires the subunits of hemoglobin to
work together so they all release O2 at the same time or are all binding O2
at the same time. Since myoglobin contains only one subunit, there is no
other group to "cooperate" with. Therefore, cooperativity is a feature
demonstrated by hemoglobin and not myoglobin.
◍ 2.5 ATP per NADH.
Answer: How many ATP molecules does NADH yield after donating
