WGU BioChem Unit 7 Quiz 2021
Which diet listed below would result in the production of ketone bodies in a healthy individual?
ANSWERS: A diet rich in fats and very low in carbohydrates
What stimulates beta-oxidation of fatty acids?
ANSWERS: The glucagon signal
If a person were eating an absolutely fat-free diet, which vitamins would he or she not get enough of?
ANSWERS: Vitamins A, D, E, and K
What is a function of this molecule?
ANSWERS: It is used to maintain membrane fluidity.
Which class of lipid is shown below?
ANSWERS: Triglyceride
If a fish raised in cold water were moved to much warmer water, how would it alter its membrane
phospholipids?
ANSWERS: Membrane phospholipids would include more longer-chain, saturated fatty acids.
What is the correct chemical formula of the following fatty acid?
ANSWERS: CH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH
Which molecule represents the structural formula CH3(CH2)5CH = CH(CH2)7COOH?ANSWERS:
Fatty acid structure (3)©WGU
What is the function of the following molecule?
ANSWERS: It is used to make cell membranes.
What is the chemical formula for the following fatty acid?
ANSWERS: CH3(CH2)4CH = CHCH2CH = CH(CH2)7COOH
In which situation would altering a protein structure lead to a disease state?
ANSWERS: A mutation in acetyl-CoA carboxylase can lead to brain damage.
Pancreatic enzymes normally have an optimal pH of about pH 8.0 or above. The pancreatic juices
can become acidified in patients with metabolic acidosis. Pancreatic lipase is an enzyme in
pancreatic juice that normally begins the process of breaking down triglycerides into fatty acids.
Which process would be impaired in patients who have altered pancreatic lipase function?
ANSWERS: Catabolism of triglycerides
Which coenzymes are needed during beta-oxidation of fatty acids?
ANSWERS: NAD+, FAD, and coenzyme A
Using beta-oxidation, how many molecules of acetyl-CoA are available from the fatty acid shown
below?
ANSWERS: 9
Which diet listed below would result in the production of ketone bodies in a healthy individual?
ANSWERS: A diet rich in fats and very low in carbohydrates
What stimulates beta-oxidation of fatty acids?
ANSWERS: The glucagon signal
If a person were eating an absolutely fat-free diet, which vitamins would he or she not get enough of?
ANSWERS: Vitamins A, D, E, and K
What is a function of this molecule?
ANSWERS: It is used to maintain membrane fluidity.
Which class of lipid is shown below?
ANSWERS: Triglyceride
If a fish raised in cold water were moved to much warmer water, how would it alter its membrane
phospholipids?
ANSWERS: Membrane phospholipids would include more longer-chain, saturated fatty acids.
What is the correct chemical formula of the following fatty acid?
ANSWERS: CH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH
Which molecule represents the structural formula CH3(CH2)5CH = CH(CH2)7COOH?ANSWERS:
Fatty acid structure (3)©WGU
What is the function of the following molecule?
ANSWERS: It is used to make cell membranes.
What is the chemical formula for the following fatty acid?
ANSWERS: CH3(CH2)4CH = CHCH2CH = CH(CH2)7COOH
In which situation would altering a protein structure lead to a disease state?
ANSWERS: A mutation in acetyl-CoA carboxylase can lead to brain damage.
Pancreatic enzymes normally have an optimal pH of about pH 8.0 or above. The pancreatic juices
can become acidified in patients with metabolic acidosis. Pancreatic lipase is an enzyme in
pancreatic juice that normally begins the process of breaking down triglycerides into fatty acids.
Which process would be impaired in patients who have altered pancreatic lipase function?
ANSWERS: Catabolism of triglycerides
Which coenzymes are needed during beta-oxidation of fatty acids?
ANSWERS: NAD+, FAD, and coenzyme A
Using beta-oxidation, how many molecules of acetyl-CoA are available from the fatty acid shown
below?
ANSWERS: 9
